C20H17Cl2NO2S — CID 94015794
2,5-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzenesulfonamide (PubChem CID 94015794) has the molecular formula C20H17Cl2NO2S and a molecular weight of 406.33 g/mol. Its IUPAC name is 2,5-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94015794 |
| Molecular Formula | C20H17Cl2NO2S |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 2,5-dichloro-N-[(S)-(4-methylphenyl)-phenylmethyl]benzenesulfonamide |
| SMILES | Cc1ccc([C@@H](NS(=O)(=O)c2cc(Cl)ccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17Cl2NO2S/c1-14-7-9-16(10-8-14)20(15-5-3-2-4-6-15)23-26(24,25)19-13-17(21)11-12-18(19)22/h2-13,20,23H,1H3/t20-/m0/s1 |
| InChIKey | UUYVUTHXSRMVHU-FQEVSTJZSA-N |
| XLogP | 5.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |