C14H11Cl2NO4S — CID 71563429
2-[(2,5-dichlorophenyl)sulfonylamino]-2-phenylacetic acid (PubChem CID 71563429) has the molecular formula C14H11Cl2NO4S and a molecular weight of 360.22 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-2-phenylacetic acid.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 71563429 |
| Molecular Formula | C14H11Cl2NO4S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-2-phenylacetic acid |
| SMILES | O=C(O)C(NS(=O)(=O)c1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl2NO4S/c15-10-6-7-11(16)12(8-10)22(20,21)17-13(14(18)19)9-4-2-1-3-5-9/h1-8,13,17H,(H,18,19) |
| InChIKey | UKZWBGGGZLSASJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |