C14H12BrCl2NO2S — CID 114296882
N-(2-bromo-1-phenylethyl)-2,5-dichlorobenzenesulfonamide (PubChem CID 114296882) has the molecular formula C14H12BrCl2NO2S and a molecular weight of 409.13 g/mol. Its IUPAC name is N-(2-bromo-1-phenylethyl)-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(2-bromo-1-phenylethyl)-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114296882 |
| Molecular Formula | C14H12BrCl2NO2S |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | N-(2-bromo-1-phenylethyl)-2,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NC(CBr)c1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12BrCl2NO2S/c15-9-13(10-4-2-1-3-5-10)18-21(19,20)14-8-11(16)6-7-12(14)17/h1-8,13,18H,9H2 |
| InChIKey | VJXNSQSZFAZNLB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|