C15H12ClN2O6S- — CID 7109158
(3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 7109158) has the molecular formula C15H12ClN2O6S- and a molecular weight of 383.79 g/mol. Its IUPAC name is (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7109158 |
| Molecular Formula | C15H12ClN2O6S- |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | O=C([O-])C[C@@H](NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O6S/c16-12-7-6-11(18(21)22)8-14(12)25(23,24)17-13(9-15(19)20)10-4-2-1-3-5-10/h1-8,13,17H,9H2,(H,19,20)/p-1/t13-/m1/s1 |
| InChIKey | LWSOOILSFLGAJX-CYBMUJFWSA-M |
| XLogP | 1.41 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|