C17H16ClN3O8S — CID 40857562
ethyl (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate (PubChem CID 40857562) has the molecular formula C17H16ClN3O8S and a molecular weight of 457.85 g/mol. Its IUPAC name is ethyl (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate.
| Compound Name | ethyl (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 40857562 |
| Molecular Formula | C17H16ClN3O8S |
| Molecular Weight | 457.85 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | ethyl (3R)-3-[(2-chloro-5-nitrophenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate |
| SMILES | CCOC(=O)C[C@@H](NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16ClN3O8S/c1-2-29-17(22)10-15(11-4-3-5-12(8-11)20(23)24)19-30(27,28)16-9-13(21(25)26)6-7-14(16)18/h3-9,15,19H,2,10H2,1H3/t15-/m1/s1 |
| InChIKey | QOLIIKQQAPDKNH-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|