C19H22ClNO6S — CID 3631613
ethyl 3-[(4-chloro-3-methoxyphenyl)sulfonylamino]-3-(4-methoxyphenyl)propanoate (PubChem CID 3631613) has the molecular formula C19H22ClNO6S and a molecular weight of 427.91 g/mol. Its IUPAC name is ethyl 3-[(4-chloro-3-methoxyphenyl)sulfonylamino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[(4-chloro-3-methoxyphenyl)sulfonylamino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 3631613 |
| Molecular Formula | C19H22ClNO6S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | ethyl 3-[(4-chloro-3-methoxyphenyl)sulfonylamino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)c1ccc(Cl)c(OC)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22ClNO6S/c1-4-27-19(22)12-17(13-5-7-14(25-2)8-6-13)21-28(23,24)15-9-10-16(20)18(11-15)26-3/h5-11,17,21H,4,12H2,1-3H3 |
| InChIKey | PVGUWEWZOSHQSM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |