C19H22N2O7S — CID 56568203
ethyl 3-(3-methoxyphenyl)-3-[(4-nitrophenyl)methylsulfonylamino]propanoate (PubChem CID 56568203) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is ethyl 3-(3-methoxyphenyl)-3-[(4-nitrophenyl)methylsulfonylamino]propanoate.
| Compound Name | ethyl 3-(3-methoxyphenyl)-3-[(4-nitrophenyl)methylsulfonylamino]propanoate |
|---|---|
| PubChem CID | 56568203 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | ethyl 3-(3-methoxyphenyl)-3-[(4-nitrophenyl)methylsulfonylamino]propanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H22N2O7S/c1-3-28-19(22)12-18(15-5-4-6-17(11-15)27-2)20-29(25,26)13-14-7-9-16(10-8-14)21(23)24/h4-11,18,20H,3,12-13H2,1-2H3 |
| InChIKey | RHOXNNAYCIZZEJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|