C21H24N2O7 — CID 55878599
ethyl 3-[(4-ethoxy-3-nitrobenzoyl)amino]-3-(3-methoxyphenyl)propanoate (PubChem CID 55878599) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is ethyl 3-[(4-ethoxy-3-nitrobenzoyl)amino]-3-(3-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[(4-ethoxy-3-nitrobenzoyl)amino]-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55878599 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | ethyl 3-[(4-ethoxy-3-nitrobenzoyl)amino]-3-(3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1ccc(OCC)c([N+](=O)[O-])c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H24N2O7/c1-4-29-19-10-9-15(12-18(19)23(26)27)21(25)22-17(13-20(24)30-5-2)14-7-6-8-16(11-14)28-3/h6-12,17H,4-5,13H2,1-3H3,(H,22,25) |
| InChIKey | KYESEJZGHGGSHH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|