C20H22ClNO6S — CID 55876426
ethyl 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-(3-methoxyphenyl)propanoate (PubChem CID 55876426) has the molecular formula C20H22ClNO6S and a molecular weight of 439.92 g/mol. Its IUPAC name is ethyl 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-(3-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55876426 |
| Molecular Formula | C20H22ClNO6S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | ethyl 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-(3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H22ClNO6S/c1-4-28-19(23)12-17(13-6-5-7-15(10-13)27-2)22-20(24)14-8-9-16(21)18(11-14)29(3,25)26/h5-11,17H,4,12H2,1-3H3,(H,22,24) |
| InChIKey | DGWIIPYEKFBVNM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |