C24H21ClN2O7 — CID 41048335
methyl (3R)-3-[[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]amino]-3-phenylpropanoate (PubChem CID 41048335) has the molecular formula C24H21ClN2O7 and a molecular weight of 484.89 g/mol. Its IUPAC name is methyl (3R)-3-[[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (3R)-3-[[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 41048335 |
| Molecular Formula | C24H21ClN2O7 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | methyl (3R)-3-[[4-(4-chloro-2-nitrophenoxy)-3-methoxybenzoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C24H21ClN2O7/c1-32-22-12-16(8-10-21(22)34-20-11-9-17(25)13-19(20)27(30)31)24(29)26-18(14-23(28)33-2)15-6-4-3-5-7-15/h3-13,18H,14H2,1-2H3,(H,26,29)/t18-/m1/s1 |
| InChIKey | ZHDRAJVJAVDJMO-GOSISDBHSA-N |
| XLogP | 5.08 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|