C19H21ClN2O7 — CID 97062743
4-(4-chloro-2-nitrophenoxy)-N-[(2R)-4-hydroxy-1-methoxybutan-2-yl]-3-methoxybenzamide (PubChem CID 97062743) has the molecular formula C19H21ClN2O7 and a molecular weight of 424.84 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenoxy)-N-[(2R)-4-hydroxy-1-methoxybutan-2-yl]-3-methoxybenzamide.
| Compound Name | 4-(4-chloro-2-nitrophenoxy)-N-[(2R)-4-hydroxy-1-methoxybutan-2-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 97062743 |
| Molecular Formula | C19H21ClN2O7 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-(4-chloro-2-nitrophenoxy)-N-[(2R)-4-hydroxy-1-methoxybutan-2-yl]-3-methoxybenzamide |
| SMILES | COC[C@@H](CCO)NC(=O)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C19H21ClN2O7/c1-27-11-14(7-8-23)21-19(24)12-3-5-17(18(9-12)28-2)29-16-6-4-13(20)10-15(16)22(25)26/h3-6,9-10,14,23H,7-8,11H2,1-2H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | IXMARLFKYFXSLN-CQSZACIVSA-N |
| XLogP | 3.18 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|