C17H19Cl2NO3S — CID 99872882
2,5-dichloro-N-[(3R)-5-hydroxy-3-phenylpentyl]benzenesulfonamide (PubChem CID 99872882) has the molecular formula C17H19Cl2NO3S and a molecular weight of 388.32 g/mol. Its IUPAC name is 2,5-dichloro-N-[(3R)-5-hydroxy-3-phenylpentyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(3R)-5-hydroxy-3-phenylpentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 99872882 |
| Molecular Formula | C17H19Cl2NO3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2,5-dichloro-N-[(3R)-5-hydroxy-3-phenylpentyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC[C@H](CCO)c1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H19Cl2NO3S/c18-15-6-7-16(19)17(12-15)24(22,23)20-10-8-14(9-11-21)13-4-2-1-3-5-13/h1-7,12,14,20-21H,8-11H2/t14-/m1/s1 |
| InChIKey | WCJAXCAYASWYNI-CQSZACIVSA-N |
| XLogP | 3.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |