C10H12Cl2N2O4S — CID 126178977
2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxyethyl)acetamide (PubChem CID 126178977) has the molecular formula C10H12Cl2N2O4S and a molecular weight of 327.19 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 126178977 |
| Molecular Formula | C10H12Cl2N2O4S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cc(Cl)ccc1Cl)NCCO |
| InChI | InChI=1S/C10H12Cl2N2O4S/c11-7-1-2-8(12)9(5-7)19(17,18)14-6-10(16)13-3-4-15/h1-2,5,14-15H,3-4,6H2,(H,13,16) |
| InChIKey | GJTOYDGWKFCQEF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |