C15H12Cl3NO4S — CID 1218599
(2-chlorophenyl)methyl 2-[(2,5-dichlorophenyl)sulfonylamino]acetate (PubChem CID 1218599) has the molecular formula C15H12Cl3NO4S and a molecular weight of 408.69 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 2-[(2,5-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | (2-chlorophenyl)methyl 2-[(2,5-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 1218599 |
| Molecular Formula | C15H12Cl3NO4S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | (2-chlorophenyl)methyl 2-[(2,5-dichlorophenyl)sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1cc(Cl)ccc1Cl)OCc1ccccc1Cl |
| InChI | InChI=1S/C15H12Cl3NO4S/c16-11-5-6-13(18)14(7-11)24(21,22)19-8-15(20)23-9-10-3-1-2-4-12(10)17/h1-7,19H,8-9H2 |
| InChIKey | ROOQGBBNLWHUSO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |