C17H16Cl2N2O6S — CID 174485832
2-amino-2-[[(2,5-dichlorophenyl)sulfonylamino]methyl]-3-oxo-3-phenylmethoxypropanoic acid (PubChem CID 174485832) has the molecular formula C17H16Cl2N2O6S and a molecular weight of 447.30 g/mol. Its IUPAC name is 2-amino-2-[[(2,5-dichlorophenyl)sulfonylamino]methyl]-3-oxo-3-phenylmethoxypropanoic acid.
| Compound Name | 2-amino-2-[[(2,5-dichlorophenyl)sulfonylamino]methyl]-3-oxo-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 174485832 |
| Molecular Formula | C17H16Cl2N2O6S |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 2-amino-2-[[(2,5-dichlorophenyl)sulfonylamino]methyl]-3-oxo-3-phenylmethoxypropanoic acid |
| SMILES | NC(CNS(=O)(=O)c1cc(Cl)ccc1Cl)(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H16Cl2N2O6S/c18-12-6-7-13(19)14(8-12)28(25,26)21-10-17(20,15(22)23)16(24)27-9-11-4-2-1-3-5-11/h1-8,21H,9-10,20H2,(H,22,23) |
| InChIKey | YUOQWAWYSDXOOK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|