C14H20ClNO4S — CID 115429946
2-[[(5-chloro-2-methylphenyl)sulfonylamino]methyl]-2-ethylbutanoic acid (PubChem CID 115429946) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is 2-[[(5-chloro-2-methylphenyl)sulfonylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[(5-chloro-2-methylphenyl)sulfonylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 115429946 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[[(5-chloro-2-methylphenyl)sulfonylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNS(=O)(=O)c1cc(Cl)ccc1C)C(=O)O |
| InChI | InChI=1S/C14H20ClNO4S/c1-4-14(5-2,13(17)18)9-16-21(19,20)12-8-11(15)7-6-10(12)3/h6-8,16H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | BHQMXWVJRCSYHH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |