C11H14ClNO5S — CID 66173227
3-[(5-chloro-2-methylphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66173227) has the molecular formula C11H14ClNO5S and a molecular weight of 307.76 g/mol. Its IUPAC name is 3-[(5-chloro-2-methylphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(5-chloro-2-methylphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66173227 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3-[(5-chloro-2-methylphenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C11H14ClNO5S/c1-7-3-4-8(12)5-9(7)19(17,18)13-6-11(2,16)10(14)15/h3-5,13,16H,6H2,1-2H3,(H,14,15) |
| InChIKey | OKHYTFSYMPYSIT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |