C10H11BrFNO5S — CID 122071383
3-[(5-bromo-2-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122071383) has the molecular formula C10H11BrFNO5S and a molecular weight of 356.17 g/mol. Its IUPAC name is 3-[(5-bromo-2-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(5-bromo-2-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122071383 |
| Molecular Formula | C10H11BrFNO5S |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 3-[(5-bromo-2-fluorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNS(=O)(=O)c1cc(Br)ccc1F)C(=O)O |
| InChI | InChI=1S/C10H11BrFNO5S/c1-10(16,9(14)15)5-13-19(17,18)8-4-6(11)2-3-7(8)12/h2-4,13,16H,5H2,1H3,(H,14,15) |
| InChIKey | MJXCTOQXIPSZNZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |