C10H11BrClNO5S — CID 122071531
3-[(2-bromo-3-chlorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122071531) has the molecular formula C10H11BrClNO5S and a molecular weight of 372.62 g/mol. Its IUPAC name is 3-[(2-bromo-3-chlorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(2-bromo-3-chlorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122071531 |
| Molecular Formula | C10H11BrClNO5S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | 3-[(2-bromo-3-chlorophenyl)sulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNS(=O)(=O)c1cccc(Cl)c1Br)C(=O)O |
| InChI | InChI=1S/C10H11BrClNO5S/c1-10(16,9(14)15)5-13-19(17,18)7-4-2-3-6(12)8(7)11/h2-4,13,16H,5H2,1H3,(H,14,15) |
| InChIKey | VTUROWUOTMALOB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |