C11H13ClFNO5S — CID 122071615
3-[(2-chloro-6-fluorophenyl)methylsulfonylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122071615) has the molecular formula C11H13ClFNO5S and a molecular weight of 325.75 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methylsulfonylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methylsulfonylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122071615 |
| Molecular Formula | C11H13ClFNO5S |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methylsulfonylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNS(=O)(=O)Cc1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H13ClFNO5S/c1-11(17,10(15)16)6-14-20(18,19)5-7-8(12)3-2-4-9(7)13/h2-4,14,17H,5-6H2,1H3,(H,15,16) |
| InChIKey | JHJUWTQSBWMZEH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |