C11H12ClFO2S — CID 79014780
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-methylpropanoic acid (PubChem CID 79014780) has the molecular formula C11H12ClFO2S and a molecular weight of 262.73 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79014780 |
| Molecular Formula | C11H12ClFO2S |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(SCc1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12ClFO2S/c1-11(2,10(14)15)16-6-7-8(12)4-3-5-9(7)13/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | XJPNOXBXKBZYME-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |