C13H18ClFS — CID 58974839
1-chloro-2-(3,3-dimethylbutylsulfanylmethyl)-3-fluorobenzene (PubChem CID 58974839) has the molecular formula C13H18ClFS and a molecular weight of 260.80 g/mol. Its IUPAC name is 1-chloro-2-(3,3-dimethylbutylsulfanylmethyl)-3-fluorobenzene.
| Compound Name | 1-chloro-2-(3,3-dimethylbutylsulfanylmethyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 58974839 |
| Molecular Formula | C13H18ClFS |
| Molecular Weight | 260.80 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-chloro-2-(3,3-dimethylbutylsulfanylmethyl)-3-fluorobenzene |
| SMILES | CC(C)(C)CCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H18ClFS/c1-13(2,3)7-8-16-9-10-11(14)5-4-6-12(10)15/h4-6H,7-9H2,1-3H3 |
| InChIKey | UHSSFSILMDQPGD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.80 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|