C9H9ClF2S — CID 114935314
2-(2-chloroethylsulfanylmethyl)-1,3-difluorobenzene (PubChem CID 114935314) has the molecular formula C9H9ClF2S and a molecular weight of 222.69 g/mol. Its IUPAC name is 2-(2-chloroethylsulfanylmethyl)-1,3-difluorobenzene.
| Compound Name | 2-(2-chloroethylsulfanylmethyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 114935314 |
| Molecular Formula | C9H9ClF2S |
| Molecular Weight | 222.69 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 2-(2-chloroethylsulfanylmethyl)-1,3-difluorobenzene |
| SMILES | Fc1cccc(F)c1CSCCCl |
| InChI | InChI=1S/C9H9ClF2S/c10-4-5-13-6-7-8(11)2-1-3-9(7)12/h1-3H,4-6H2 |
| InChIKey | HGQZRWKWQQRJCF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|