C7H5F2IS — CID 143620116
(2,6-difluorophenyl)methyl thiohypoiodite (PubChem CID 143620116) has the molecular formula C7H5F2IS and a molecular weight of 286.08 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl thiohypoiodite.
| Compound Name | (2,6-difluorophenyl)methyl thiohypoiodite |
|---|---|
| PubChem CID | 143620116 |
| Molecular Formula | C7H5F2IS |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | (2,6-difluorophenyl)methyl thiohypoiodite |
| SMILES | Fc1cccc(F)c1CSI |
| InChI | InChI=1S/C7H5F2IS/c8-6-2-1-3-7(9)5(6)4-11-10/h1-3H,4H2 |
| InChIKey | RWBLNRHECSDAKG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|