C7H6BrClF2 — CID 175540499
2-(bromomethyl)-1,3-difluorobenzene;hydrochloride (PubChem CID 175540499) has the molecular formula C7H6BrClF2 and a molecular weight of 243.48 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-difluorobenzene;hydrochloride.
| Compound Name | 2-(bromomethyl)-1,3-difluorobenzene;hydrochloride |
|---|---|
| PubChem CID | 175540499 |
| Molecular Formula | C7H6BrClF2 |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 241.93 |
| IUPAC Name | 2-(bromomethyl)-1,3-difluorobenzene;hydrochloride |
| SMILES | Cl.Fc1cccc(F)c1CBr |
| InChI | InChI=1S/C7H5BrF2.ClH/c8-4-5-6(9)2-1-3-7(5)10;/h1-3H,4H2;1H |
| InChIKey | YOBJTKIIYPCGMU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|