C13H5BrF6 — CID 134627869
1-(bromomethyl)-4-(2,3-difluorophenyl)-2,3,5,6-tetrafluorobenzene (PubChem CID 134627869) has the molecular formula C13H5BrF6 and a molecular weight of 355.08 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(2,3-difluorophenyl)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-(bromomethyl)-4-(2,3-difluorophenyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 134627869 |
| Molecular Formula | C13H5BrF6 |
| Molecular Weight | 355.08 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 1-(bromomethyl)-4-(2,3-difluorophenyl)-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1cccc(-c2c(F)c(F)c(CBr)c(F)c2F)c1F |
| InChI | InChI=1S/C13H5BrF6/c14-4-6-10(17)12(19)8(13(20)11(6)18)5-2-1-3-7(15)9(5)16/h1-3H,4H2 |
| InChIKey | VJIYLRYRDYCCLU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.08 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|