C18H6F8 — CID 157170971
1-[2-(2,3-difluorophenyl)-4-fluorophenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 157170971) has the molecular formula C18H6F8 and a molecular weight of 374.23 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)-4-fluorophenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[2-(2,3-difluorophenyl)-4-fluorophenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 157170971 |
| Molecular Formula | C18H6F8 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)-4-fluorophenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1ccc(-c2c(F)c(F)c(F)c(F)c2F)c(-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C18H6F8/c19-7-4-5-8(10(6-7)9-2-1-3-11(20)13(9)21)12-14(22)16(24)18(26)17(25)15(12)23/h1-6H |
| InChIKey | ANLNZDGTTJDJEP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|