C17H8F5N — CID 133088897
2,6-bis(2,3-difluorophenyl)-4-fluoropyridine (PubChem CID 133088897) has the molecular formula C17H8F5N and a molecular weight of 321.25 g/mol. Its IUPAC name is 2,6-bis(2,3-difluorophenyl)-4-fluoropyridine.
| Compound Name | 2,6-bis(2,3-difluorophenyl)-4-fluoropyridine |
|---|---|
| PubChem CID | 133088897 |
| Molecular Formula | C17H8F5N |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2,6-bis(2,3-difluorophenyl)-4-fluoropyridine |
| SMILES | Fc1cc(-c2cccc(F)c2F)nc(-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C17H8F5N/c18-9-7-14(10-3-1-5-12(19)16(10)21)23-15(8-9)11-4-2-6-13(20)17(11)22/h1-8H |
| InChIKey | MACZWIJFEFATEF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |