2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid

C13H10F2N2O2 — CID 133086696

IUPAC2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid
SMILESNc1ccc(-c2cccc(F)c2F)nc1CC(=O)O
InChIInChI=1S/C13H10F2N2O2/c14-8-3-1-2-7(13(8)15)10-5-4-9(16)11(17-10)6-12(18)19/h1-5H,6,16H2,(H,18,19)
InChIKeyALLZJABECQJIBK-UHFFFAOYSA-N
MW264.23 g/mol
LogP2.24
Rot. Bonds3

About 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid

2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid (PubChem CID 133086696) has the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid.

Molecular Properties

Compound Name2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid
PubChem CID133086696
Molecular FormulaC13H10F2N2O2
Molecular Weight264.23 g/mol
Exact Mass264.07
IUPAC Name2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid
SMILESNc1ccc(-c2cccc(F)c2F)nc1CC(=O)O
InChIInChI=1S/C13H10F2N2O2/c14-8-3-1-2-7(13(8)15)10-5-4-9(16)11(17-10)6-12(18)19/h1-5H,6,16H2,(H,18,19)
InChIKeyALLZJABECQJIBK-UHFFFAOYSA-N
XLogP2.24
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 52.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid?
The IUPAC name of 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid (CID 133086696) is 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid.
What is the SMILES notation for 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid?
The canonical SMILES for 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid is Nc1ccc(-c2cccc(F)c2F)nc1CC(=O)O.
What is the InChIKey of 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid?
The InChIKey is ALLZJABECQJIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N2O2/c14-8-3-1-2-7(13(8)15)10-5-4-9(16)11(17-10)6-12(18)19/h1-5H,6,16H2,(H,18,19).
What are the key properties of 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid?
2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid has a molecular weight of 264.23 g/mol, XLogP of 2.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-amino-6-(2,3-difluorophenyl)-2-pyridinyl]acetic acid is sourced from PubChem (CID 133086696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).