2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid

C14H9F3O2 — CID 134630574

IUPAC2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid
SMILESO=C(O)Cc1ccc(F)c(-c2cccc(F)c2F)c1
InChIInChI=1S/C14H9F3O2/c15-11-5-4-8(7-13(18)19)6-10(11)9-2-1-3-12(16)14(9)17/h1-6H,7H2,(H,18,19)
InChIKeySTLDPLCQLITGKR-UHFFFAOYSA-N
MW266.22 g/mol
LogP3.40
Rot. Bonds3

About 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid

2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid (PubChem CID 134630574) has the molecular formula C14H9F3O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid.

Molecular Properties

Compound Name2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid
PubChem CID134630574
Molecular FormulaC14H9F3O2
Molecular Weight266.22 g/mol
Exact Mass266.06
IUPAC Name2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid
SMILESO=C(O)Cc1ccc(F)c(-c2cccc(F)c2F)c1
InChIInChI=1S/C14H9F3O2/c15-11-5-4-8(7-13(18)19)6-10(11)9-2-1-3-12(16)14(9)17/h1-6H,7H2,(H,18,19)
InChIKeySTLDPLCQLITGKR-UHFFFAOYSA-N
XLogP3.40
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.22
LogP ≤ 53.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[3-(2,3-dichlorophenyl)-4-fluorophenyl]acetic acid
CID 118852499
2-[5-(2,3-difluorophenyl)-6-fluoro-3-pyridinyl]acetic acid
CID 133088994
2-[3-(2,3-difluorophenyl)-4-fluorophenyl]ethanol
CID 170453866
2-(4-fluoro-3-pyridin-4-ylphenyl)acetic acid
CID 46315783
2-(3,4-difluoro-5-phenylphenyl)acetic acid
CID 117372910
2-(2,3-difluorophenyl)acetic acid;hydrochloride
CID 172702403
2-[2-(2-fluorophenyl)-3H-benzimidazol-5-yl]acetic acid
CID 82141996
2-[3-(2-fluoro-5-methoxyphenyl)-4-methoxyphenyl]acetic acid
CID 176513629
2-[5-(2,3-difluorophenyl)-2-fluoro-3-pyridinyl]acetic acid
CID 133088999
2-[3-(bromomethyl)-4-fluorophenyl]acetic acid
CID 99769915
3-(2,3-difluorophenyl)-2-fluorobenzoic acid
CID 113242003
1,2-difluoro-3-(2-fluoro-5-iodophenyl)benzene
CID 134630207

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid?
The IUPAC name of 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid (CID 134630574) is 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid.
What is the SMILES notation for 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid?
The canonical SMILES for 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid is O=C(O)Cc1ccc(F)c(-c2cccc(F)c2F)c1.
What is the InChIKey of 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid?
The InChIKey is STLDPLCQLITGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3O2/c15-11-5-4-8(7-13(18)19)6-10(11)9-2-1-3-12(16)14(9)17/h1-6H,7H2,(H,18,19).
What are the key properties of 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid?
2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid has a molecular weight of 266.22 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,3-difluorophenyl)-4-fluorophenyl]acetic acid is sourced from PubChem (CID 134630574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).