C16H15FO4 — CID 176513629
2-[3-(2-fluoro-5-methoxyphenyl)-4-methoxyphenyl]acetic acid (PubChem CID 176513629) has the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-[3-(2-fluoro-5-methoxyphenyl)-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-(2-fluoro-5-methoxyphenyl)-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 176513629 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[3-(2-fluoro-5-methoxyphenyl)-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(F)c(-c2cc(CC(=O)O)ccc2OC)c1 |
| InChI | InChI=1S/C16H15FO4/c1-20-11-4-5-14(17)12(9-11)13-7-10(8-16(18)19)3-6-15(13)21-2/h3-7,9H,8H2,1-2H3,(H,18,19) |
| InChIKey | ADRKTBMXMGUBCU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |