2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid

C18H16FNO4 — CID 4021038

IUPAC2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid
SMILESCOc1ccc(OC)c(-c2[nH]c3c(F)cccc3c2CC(=O)O)c1
InChIInChI=1S/C18H16FNO4/c1-23-10-6-7-15(24-2)13(8-10)17-12(9-16(21)22)11-4-3-5-14(19)18(11)20-17/h3-8,20H,9H2,1-2H3,(H,21,22)
InChIKeySTXIEODVCMFDGB-UHFFFAOYSA-N
MW329.33 g/mol
LogP3.62
Rot. Bonds5

About 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid

2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid (PubChem CID 4021038) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid
PubChem CID4021038
Molecular FormulaC18H16FNO4
Molecular Weight329.33 g/mol
Exact Mass329.11
IUPAC Name2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid
SMILESCOc1ccc(OC)c(-c2[nH]c3c(F)cccc3c2CC(=O)O)c1
InChIInChI=1S/C18H16FNO4/c1-23-10-6-7-15(24-2)13(8-10)17-12(9-16(21)22)11-4-3-5-14(19)18(11)20-17/h3-8,20H,9H2,1-2H3,(H,21,22)
InChIKeySTXIEODVCMFDGB-UHFFFAOYSA-N
XLogP3.62
TPSA71.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.33
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid?
The IUPAC name of 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid (CID 4021038) is 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid.
What is the SMILES notation for 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid?
The canonical SMILES for 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid is COc1ccc(OC)c(-c2[nH]c3c(F)cccc3c2CC(=O)O)c1.
What is the InChIKey of 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid?
The InChIKey is STXIEODVCMFDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO4/c1-23-10-6-7-15(24-2)13(8-10)17-12(9-16(21)22)11-4-3-5-14(19)18(11)20-17/h3-8,20H,9H2,1-2H3,(H,21,22).
What are the key properties of 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid?
2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid has a molecular weight of 329.33 g/mol, XLogP of 3.62, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid is sourced from PubChem (CID 4021038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).