C20H21NO5 — CID 3977556
2-[7-methyl-2-(2,3,4-trimethoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3977556) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[7-methyl-2-(2,3,4-trimethoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[7-methyl-2-(2,3,4-trimethoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3977556 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[7-methyl-2-(2,3,4-trimethoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | COc1ccc(-c2[nH]c3c(C)cccc3c2CC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C20H21NO5/c1-11-6-5-7-12-14(10-16(22)23)18(21-17(11)12)13-8-9-15(24-2)20(26-4)19(13)25-3/h5-9,21H,10H2,1-4H3,(H,22,23) |
| InChIKey | MTZHGUFXQBZEBB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |