C21H26N2O2 — CID 4214505
4-[2-(2,3-dimethoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4214505) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[2-(2,3-dimethoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2,3-dimethoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4214505 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[2-(2,3-dimethoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1cccc(-c2[nH]c3c(C)cccc3c2CCCCN)c1OC |
| InChI | InChI=1S/C21H26N2O2/c1-14-8-6-10-15-16(9-4-5-13-22)20(23-19(14)15)17-11-7-12-18(24-2)21(17)25-3/h6-8,10-12,23H,4-5,9,13,22H2,1-3H3 |
| InChIKey | ZLCWKDSFUFJZNB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|