C22H26N2O4 — CID 5035920
2-[3-(4-aminobutyl)-2-(2,3-dimethoxyphenyl)-1H-indol-5-yl]acetic acid (PubChem CID 5035920) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[3-(4-aminobutyl)-2-(2,3-dimethoxyphenyl)-1H-indol-5-yl]acetic acid.
| Compound Name | 2-[3-(4-aminobutyl)-2-(2,3-dimethoxyphenyl)-1H-indol-5-yl]acetic acid |
|---|---|
| PubChem CID | 5035920 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[3-(4-aminobutyl)-2-(2,3-dimethoxyphenyl)-1H-indol-5-yl]acetic acid |
| SMILES | COc1cccc(-c2[nH]c3ccc(CC(=O)O)cc3c2CCCCN)c1OC |
| InChI | InChI=1S/C22H26N2O4/c1-27-19-8-5-7-16(22(19)28-2)21-15(6-3-4-11-23)17-12-14(13-20(25)26)9-10-18(17)24-21/h5,7-10,12,24H,3-4,6,11,13,23H2,1-2H3,(H,25,26) |
| InChIKey | GOBKYGDBAIWTJV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|