C18H16ClNO4 — CID 3275365
2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3275365) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3275365 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | COc1cccc(-c2[nH]c3ccc(Cl)cc3c2CC(=O)O)c1OC |
| InChI | InChI=1S/C18H16ClNO4/c1-23-15-5-3-4-11(18(15)24-2)17-13(9-16(21)22)12-8-10(19)6-7-14(12)20-17/h3-8,20H,9H2,1-2H3,(H,21,22) |
| InChIKey | REHFRVRCKPRQIH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |