2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid

C18H16ClNO4 — CID 3275365

IUPAC2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid
SMILESCOc1cccc(-c2[nH]c3ccc(Cl)cc3c2CC(=O)O)c1OC
InChIInChI=1S/C18H16ClNO4/c1-23-15-5-3-4-11(18(15)24-2)17-13(9-16(21)22)12-8-10(19)6-7-14(12)20-17/h3-8,20H,9H2,1-2H3,(H,21,22)
InChIKeyREHFRVRCKPRQIH-UHFFFAOYSA-N
MW345.78 g/mol
LogP4.13
Rot. Bonds5

About 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid

2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3275365) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid
PubChem CID3275365
Molecular FormulaC18H16ClNO4
Molecular Weight345.78 g/mol
Exact Mass345.08
IUPAC Name2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid
SMILESCOc1cccc(-c2[nH]c3ccc(Cl)cc3c2CC(=O)O)c1OC
InChIInChI=1S/C18H16ClNO4/c1-23-15-5-3-4-11(18(15)24-2)17-13(9-16(21)22)12-8-10(19)6-7-14(12)20-17/h3-8,20H,9H2,1-2H3,(H,21,22)
InChIKeyREHFRVRCKPRQIH-UHFFFAOYSA-N
XLogP4.13
TPSA71.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.78
LogP ≤ 54.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid?
The IUPAC name of 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid (CID 3275365) is 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid?
The canonical SMILES for 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid is COc1cccc(-c2[nH]c3ccc(Cl)cc3c2CC(=O)O)c1OC.
What is the InChIKey of 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid?
The InChIKey is REHFRVRCKPRQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClNO4/c1-23-15-5-3-4-11(18(15)24-2)17-13(9-16(21)22)12-8-10(19)6-7-14(12)20-17/h3-8,20H,9H2,1-2H3,(H,21,22).
What are the key properties of 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid?
2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid has a molecular weight of 345.78 g/mol, XLogP of 4.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-2-(2,3-dimethoxyphenyl)-1H-indol-3-yl]acetic acid is sourced from PubChem (CID 3275365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).