2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid

C17H13F2NO3 — CID 4667197

IUPAC2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid
SMILESCOc1ccc2[nH]c(-c3ccc(F)cc3F)c(CC(=O)O)c2c1
InChIInChI=1S/C17H13F2NO3/c1-23-10-3-5-15-12(7-10)13(8-16(21)22)17(20-15)11-4-2-9(18)6-14(11)19/h2-7,20H,8H2,1H3,(H,21,22)
InChIKeyVRZJNLKCFOQHRY-UHFFFAOYSA-N
MW317.29 g/mol
LogP3.75
Rot. Bonds4

About 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid

2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid (PubChem CID 4667197) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid
PubChem CID4667197
Molecular FormulaC17H13F2NO3
Molecular Weight317.29 g/mol
Exact Mass317.09
IUPAC Name2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid
SMILESCOc1ccc2[nH]c(-c3ccc(F)cc3F)c(CC(=O)O)c2c1
InChIInChI=1S/C17H13F2NO3/c1-23-10-3-5-15-12(7-10)13(8-16(21)22)17(20-15)11-4-2-9(18)6-14(11)19/h2-7,20H,8H2,1H3,(H,21,22)
InChIKeyVRZJNLKCFOQHRY-UHFFFAOYSA-N
XLogP3.75
TPSA62.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.29
LogP ≤ 53.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid?
The IUPAC name of 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid (CID 4667197) is 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid.
What is the SMILES notation for 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid?
The canonical SMILES for 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid is COc1ccc2[nH]c(-c3ccc(F)cc3F)c(CC(=O)O)c2c1.
What is the InChIKey of 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid?
The InChIKey is VRZJNLKCFOQHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2NO3/c1-23-10-3-5-15-12(7-10)13(8-16(21)22)17(20-15)11-4-2-9(18)6-14(11)19/h2-7,20H,8H2,1H3,(H,21,22).
What are the key properties of 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid?
2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid has a molecular weight of 317.29 g/mol, XLogP of 3.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-difluorophenyl)-5-methoxy-1H-indol-3-yl]acetic acid is sourced from PubChem (CID 4667197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).