C18H15F2NO2 — CID 5123254
2-[2-(2,4-difluorophenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid (PubChem CID 5123254) has the molecular formula C18H15F2NO2 and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(2,4-difluorophenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5123254 |
| Molecular Formula | C18H15F2NO2 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid |
| SMILES | Cc1cc(C)c2[nH]c(-c3ccc(F)cc3F)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C18H15F2NO2/c1-9-5-10(2)17-13(6-9)14(8-16(22)23)18(21-17)12-4-3-11(19)7-15(12)20/h3-7,21H,8H2,1-2H3,(H,22,23) |
| InChIKey | ONPGQFLUHQPRKM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |