C20H21NO2 — CID 5217897
2-[2-(4-ethylphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid (PubChem CID 5217897) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[2-(4-ethylphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(4-ethylphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5217897 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[2-(4-ethylphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid |
| SMILES | CCc1ccc(-c2[nH]c3c(C)cc(C)cc3c2CC(=O)O)cc1 |
| InChI | InChI=1S/C20H21NO2/c1-4-14-5-7-15(8-6-14)20-17(11-18(22)23)16-10-12(2)9-13(3)19(16)21-20/h5-10,21H,4,11H2,1-3H3,(H,22,23) |
| InChIKey | UWEKLJWDYZMCOS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |