C20H21NO3 — CID 4306468
2-[2-(3-ethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid (PubChem CID 4306468) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[2-(3-ethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(3-ethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 4306468 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[2-(3-ethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1cccc(-c2[nH]c3c(C)cc(C)cc3c2CC(=O)O)c1 |
| InChI | InChI=1S/C20H21NO3/c1-4-24-15-7-5-6-14(10-15)20-17(11-18(22)23)16-9-12(2)8-13(3)19(16)21-20/h5-10,21H,4,11H2,1-3H3,(H,22,23) |
| InChIKey | LGPLHVJEGVCPFH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |