C18H16INO3 — CID 3475473
2-[2-(3-ethoxyphenyl)-5-iodo-1H-indol-3-yl]acetic acid (PubChem CID 3475473) has the molecular formula C18H16INO3 and a molecular weight of 421.23 g/mol. Its IUPAC name is 2-[2-(3-ethoxyphenyl)-5-iodo-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(3-ethoxyphenyl)-5-iodo-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3475473 |
| Molecular Formula | C18H16INO3 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-[2-(3-ethoxyphenyl)-5-iodo-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1cccc(-c2[nH]c3ccc(I)cc3c2CC(=O)O)c1 |
| InChI | InChI=1S/C18H16INO3/c1-2-23-13-5-3-4-11(8-13)18-15(10-17(21)22)14-9-12(19)6-7-16(14)20-18/h3-9,20H,2,10H2,1H3,(H,21,22) |
| InChIKey | MWUYSGJTAQEKCH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|