C22H25NO5 — CID 3921291
2-[2-(3,4-diethoxyphenyl)-5-ethoxy-1H-indol-3-yl]acetic acid (PubChem CID 3921291) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-[2-(3,4-diethoxyphenyl)-5-ethoxy-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(3,4-diethoxyphenyl)-5-ethoxy-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3921291 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[2-(3,4-diethoxyphenyl)-5-ethoxy-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1ccc2[nH]c(-c3ccc(OCC)c(OCC)c3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C22H25NO5/c1-4-26-15-8-9-18-16(12-15)17(13-21(24)25)22(23-18)14-7-10-19(27-5-2)20(11-14)28-6-3/h7-12,23H,4-6,13H2,1-3H3,(H,24,25) |
| InChIKey | VETDPVUXUQQIKZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |