C31H33NO5 — CID 4551548
2-[5-cyclohexyloxy-2-(3-ethoxy-4-phenylmethoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 4551548) has the molecular formula C31H33NO5 and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-[5-cyclohexyloxy-2-(3-ethoxy-4-phenylmethoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-cyclohexyloxy-2-(3-ethoxy-4-phenylmethoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 4551548 |
| Molecular Formula | C31H33NO5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 2-[5-cyclohexyloxy-2-(3-ethoxy-4-phenylmethoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1cc(-c2[nH]c3ccc(OC4CCCCC4)cc3c2CC(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H33NO5/c1-2-35-29-17-22(13-16-28(29)36-20-21-9-5-3-6-10-21)31-26(19-30(33)34)25-18-24(14-15-27(25)32-31)37-23-11-7-4-8-12-23/h3,5-6,9-10,13-18,23,32H,2,4,7-8,11-12,19-20H2,1H3,(H,33,34) |
| InChIKey | BKZYHIZDQXEXNI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |