C25H20F3NO5 — CID 5178420
2-[2-(3-methoxy-4-phenylmethoxyphenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetic acid (PubChem CID 5178420) has the molecular formula C25H20F3NO5 and a molecular weight of 471.43 g/mol. Its IUPAC name is 2-[2-(3-methoxy-4-phenylmethoxyphenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(3-methoxy-4-phenylmethoxyphenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5178420 |
| Molecular Formula | C25H20F3NO5 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[2-(3-methoxy-4-phenylmethoxyphenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetic acid |
| SMILES | COc1cc(-c2[nH]c3ccc(OC(F)(F)F)cc3c2CC(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H20F3NO5/c1-32-22-11-16(7-10-21(22)33-14-15-5-3-2-4-6-15)24-19(13-23(30)31)18-12-17(34-25(26,27)28)8-9-20(18)29-24/h2-12,29H,13-14H2,1H3,(H,30,31) |
| InChIKey | UTUVECYTNUTBFU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |