C19H18ClNO4 — CID 3944744
2-[5-chloro-2-(4-ethoxy-3-methoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 3944744) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is 2-[5-chloro-2-(4-ethoxy-3-methoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-(4-ethoxy-3-methoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3944744 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[5-chloro-2-(4-ethoxy-3-methoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1ccc(-c2[nH]c3ccc(Cl)cc3c2CC(=O)O)cc1OC |
| InChI | InChI=1S/C19H18ClNO4/c1-3-25-16-7-4-11(8-17(16)24-2)19-14(10-18(22)23)13-9-12(20)5-6-15(13)21-19/h4-9,21H,3,10H2,1-2H3,(H,22,23) |
| InChIKey | FQVAKMYLVSVAKP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |