C20H20ClNO4 — CID 3375280
2-[6-chloro-2-(4-ethoxy-3-methoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid (PubChem CID 3375280) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is 2-[6-chloro-2-(4-ethoxy-3-methoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-2-(4-ethoxy-3-methoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3375280 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[6-chloro-2-(4-ethoxy-3-methoxyphenyl)-7-methyl-1H-indol-3-yl]acetic acid |
| SMILES | CCOc1ccc(-c2[nH]c3c(C)c(Cl)ccc3c2CC(=O)O)cc1OC |
| InChI | InChI=1S/C20H20ClNO4/c1-4-26-16-8-5-12(9-17(16)25-3)20-14(10-18(23)24)13-6-7-15(21)11(2)19(13)22-20/h5-9,22H,4,10H2,1-3H3,(H,23,24) |
| InChIKey | FKDPNFRHSJLXAI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |