C18H16FNO4 — CID 4620548
2-[2-(3,4-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid (PubChem CID 4620548) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 4620548 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-7-fluoro-1H-indol-3-yl]acetic acid |
| SMILES | COc1ccc(-c2[nH]c3c(F)cccc3c2CC(=O)O)cc1OC |
| InChI | InChI=1S/C18H16FNO4/c1-23-14-7-6-10(8-15(14)24-2)17-12(9-16(21)22)11-4-3-5-13(19)18(11)20-17/h3-8,20H,9H2,1-2H3,(H,21,22) |
| InChIKey | VXEWXEHENAYOKC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |