C21H22FNO4 — CID 4587028
2-[5-butoxy-2-(3-fluoro-4-methoxyphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 4587028) has the molecular formula C21H22FNO4 and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-[5-butoxy-2-(3-fluoro-4-methoxyphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-butoxy-2-(3-fluoro-4-methoxyphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 4587028 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[5-butoxy-2-(3-fluoro-4-methoxyphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | CCCCOc1ccc2[nH]c(-c3ccc(OC)c(F)c3)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C21H22FNO4/c1-3-4-9-27-14-6-7-18-15(11-14)16(12-20(24)25)21(23-18)13-5-8-19(26-2)17(22)10-13/h5-8,10-11,23H,3-4,9,12H2,1-2H3,(H,24,25) |
| InChIKey | UVVJALUTPKIOND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|