C22H24BrNO4 — CID 4218766
2-[2-(5-bromo-2-ethoxyphenyl)-5-butoxy-1H-indol-3-yl]acetic acid (PubChem CID 4218766) has the molecular formula C22H24BrNO4 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-ethoxyphenyl)-5-butoxy-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(5-bromo-2-ethoxyphenyl)-5-butoxy-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 4218766 |
| Molecular Formula | C22H24BrNO4 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[2-(5-bromo-2-ethoxyphenyl)-5-butoxy-1H-indol-3-yl]acetic acid |
| SMILES | CCCCOc1ccc2[nH]c(-c3cc(Br)ccc3OCC)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C22H24BrNO4/c1-3-5-10-28-15-7-8-19-16(12-15)17(13-21(25)26)22(24-19)18-11-14(23)6-9-20(18)27-4-2/h6-9,11-12,24H,3-5,10,13H2,1-2H3,(H,25,26) |
| InChIKey | DHUUHYYSKQLDOI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|