C18H14BrNO5 — CID 3633848
2-(5-bromo-2-methoxyphenyl)-3-(carboxymethyl)-1H-indole-5-carboxylic acid (PubChem CID 3633848) has the molecular formula C18H14BrNO5 and a molecular weight of 404.22 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-3-(carboxymethyl)-1H-indole-5-carboxylic acid.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-3-(carboxymethyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 3633848 |
| Molecular Formula | C18H14BrNO5 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-3-(carboxymethyl)-1H-indole-5-carboxylic acid |
| SMILES | COc1ccc(Br)cc1-c1[nH]c2ccc(C(=O)O)cc2c1CC(=O)O |
| InChI | InChI=1S/C18H14BrNO5/c1-25-15-5-3-10(19)7-13(15)17-12(8-16(21)22)11-6-9(18(23)24)2-4-14(11)20-17/h2-7,20H,8H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | LTVQGOASSSZSRR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |